For Protein and Peptide conjugate

Mono-functional Linear PEGs

Bi-Functional PEGs

Branched PEGs

Forked PEGs

Heterofunctional PEGs

Degradable PEGs

Releasable PEGs

  1. 1
  2. 15
  3. 16
  4. 17
  5. 18
Boc-NH(CH2)3-O-PEG-COO-NHS, Mw 10,000

Make to order

Boc-NH(CH2)3-O-PEG-COO-NHS, Mw 20,000

Make to order

N3-PEG-Carbonate, Mw=2000

Make to order

N3-PEG-Carbonate Mw=3400

Make to order

N3-PEG-Carbonate Mw=5000

Make to order

2arm branched PEG, -COO-NHS, Mw 40,000
Amine-PEG-Azide, Mw=2,000

Make to order

-NHCO-(CH2)2-Maleimide Mw 40,000 (20,000x2)
Molecular weight: 40,000 (20,000×2)
Molecular weight: 20000
  1. 1
  2. 15
  3. 16
  4. 17
  5. 18