SUNBRIGHT DE-200HS
NHS-OCO(CH2)5O-PEG-(CH2)5COO-NHS, Mw 20,000
Chemical Name: α-[6-[(2,5-dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl]-ω-[6-[(2,5-dioxo-1-pyrrolidinyl)oxy]-6-oxohexyloxy]-, polyoxyethylene
CAS#: 1092952-05-0
SUNBRIGHT DE-200HS is a homobifunctional NHS ester-PEG with a 20,000 Da PEG chain. The NHS groups at both ends react with amine-containing molecules to form a stable amide bonds. After PEGylation, the AS type is generally resistant to hydrolysis, making it suitable for the applications that require prolonged stability under aqueous or physiological conditions.
